C14H19NO — CID 65255390
2,2-dimethyl-5-(3-methylphenoxy)pentanenitrile (PubChem CID 65255390) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 2,2-dimethyl-5-(3-methylphenoxy)pentanenitrile.
| Compound Name | 2,2-dimethyl-5-(3-methylphenoxy)pentanenitrile |
|---|---|
| PubChem CID | 65255390 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 2,2-dimethyl-5-(3-methylphenoxy)pentanenitrile |
| SMILES | Cc1cccc(OCCCC(C)(C)C#N)c1 |
| InChI | InChI=1S/C14H19NO/c1-12-6-4-7-13(10-12)16-9-5-8-14(2,3)11-15/h4,6-7,10H,5,8-9H2,1-3H3 |
| InChIKey | GUMGLYUGZNRZID-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|