C14H16ClF2NO — CID 79888422
5-[4-(chloromethyl)-2,6-difluorophenoxy]-2,2-dimethylpentanenitrile (PubChem CID 79888422) has the molecular formula C14H16ClF2NO and a molecular weight of 287.74 g/mol. Its IUPAC name is 5-[4-(chloromethyl)-2,6-difluorophenoxy]-2,2-dimethylpentanenitrile.
| Compound Name | 5-[4-(chloromethyl)-2,6-difluorophenoxy]-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 79888422 |
| Molecular Formula | C14H16ClF2NO |
| Molecular Weight | 287.74 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 5-[4-(chloromethyl)-2,6-difluorophenoxy]-2,2-dimethylpentanenitrile |
| SMILES | CC(C)(C#N)CCCOc1c(F)cc(CCl)cc1F |
| InChI | InChI=1S/C14H16ClF2NO/c1-14(2,9-18)4-3-5-19-13-11(16)6-10(8-15)7-12(13)17/h6-7H,3-5,8H2,1-2H3 |
| InChIKey | ZMMUXJLBSXGFBH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.74 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|