C14H17ClN2O3 — CID 65255941
5-[5-(chloromethyl)-2-nitrophenoxy]-2,2-dimethylpentanenitrile (PubChem CID 65255941) has the molecular formula C14H17ClN2O3 and a molecular weight of 296.75 g/mol. Its IUPAC name is 5-[5-(chloromethyl)-2-nitrophenoxy]-2,2-dimethylpentanenitrile.
| Compound Name | 5-[5-(chloromethyl)-2-nitrophenoxy]-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 65255941 |
| Molecular Formula | C14H17ClN2O3 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 5-[5-(chloromethyl)-2-nitrophenoxy]-2,2-dimethylpentanenitrile |
| SMILES | CC(C)(C#N)CCCOc1cc(CCl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H17ClN2O3/c1-14(2,10-16)6-3-7-20-13-8-11(9-15)4-5-12(13)17(18)19/h4-5,8H,3,6-7,9H2,1-2H3 |
| InChIKey | VLTVJHXFIREYOS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 76.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|