C14H17FN2O3 — CID 114416696
5-(2-fluoro-5-methyl-4-nitrophenoxy)-2,2-dimethylpentanenitrile (PubChem CID 114416696) has the molecular formula C14H17FN2O3 and a molecular weight of 280.30 g/mol. Its IUPAC name is 5-(2-fluoro-5-methyl-4-nitrophenoxy)-2,2-dimethylpentanenitrile.
| Compound Name | 5-(2-fluoro-5-methyl-4-nitrophenoxy)-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 114416696 |
| Molecular Formula | C14H17FN2O3 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 5-(2-fluoro-5-methyl-4-nitrophenoxy)-2,2-dimethylpentanenitrile |
| SMILES | Cc1cc(OCCCC(C)(C)C#N)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H17FN2O3/c1-10-7-13(11(15)8-12(10)17(18)19)20-6-4-5-14(2,3)9-16/h7-8H,4-6H2,1-3H3 |
| InChIKey | RRALGONBFORTGD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 76.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|