C13H16N2O3 — CID 65257079
2,2-dimethyl-4-(4-methyl-2-nitrophenoxy)butanenitrile (PubChem CID 65257079) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 2,2-dimethyl-4-(4-methyl-2-nitrophenoxy)butanenitrile.
| Compound Name | 2,2-dimethyl-4-(4-methyl-2-nitrophenoxy)butanenitrile |
|---|---|
| PubChem CID | 65257079 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 2,2-dimethyl-4-(4-methyl-2-nitrophenoxy)butanenitrile |
| SMILES | Cc1ccc(OCCC(C)(C)C#N)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H16N2O3/c1-10-4-5-12(11(8-10)15(16)17)18-7-6-13(2,3)9-14/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | BPJWCDJBTRRAHA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 76.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|