C13H14N2O4 — CID 65252971
4-(2-formyl-4-nitrophenoxy)-2,2-dimethylbutanenitrile (PubChem CID 65252971) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is 4-(2-formyl-4-nitrophenoxy)-2,2-dimethylbutanenitrile.
| Compound Name | 4-(2-formyl-4-nitrophenoxy)-2,2-dimethylbutanenitrile |
|---|---|
| PubChem CID | 65252971 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 4-(2-formyl-4-nitrophenoxy)-2,2-dimethylbutanenitrile |
| SMILES | CC(C)(C#N)CCOc1ccc([N+](=O)[O-])cc1C=O |
| InChI | InChI=1S/C13H14N2O4/c1-13(2,9-14)5-6-19-12-4-3-11(15(17)18)7-10(12)8-16/h3-4,7-8H,5-6H2,1-2H3 |
| InChIKey | AXYWVUSCGKDYTK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 93.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|