C14H16N2O5 — CID 65252970
4-(4-formyl-2-methoxy-5-nitrophenoxy)-2,2-dimethylbutanenitrile (PubChem CID 65252970) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is 4-(4-formyl-2-methoxy-5-nitrophenoxy)-2,2-dimethylbutanenitrile.
| Compound Name | 4-(4-formyl-2-methoxy-5-nitrophenoxy)-2,2-dimethylbutanenitrile |
|---|---|
| PubChem CID | 65252970 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 4-(4-formyl-2-methoxy-5-nitrophenoxy)-2,2-dimethylbutanenitrile |
| SMILES | COc1cc(C=O)c([N+](=O)[O-])cc1OCCC(C)(C)C#N |
| InChI | InChI=1S/C14H16N2O5/c1-14(2,9-15)4-5-21-13-7-11(16(18)19)10(8-17)6-12(13)20-3/h6-8H,4-5H2,1-3H3 |
| InChIKey | HCVGHLAYXJNFJI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 102.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|