C10H8F3NO5 — CID 43311615
5-methoxy-2-nitro-4-(2,2,2-trifluoroethoxy)benzaldehyde (PubChem CID 43311615) has the molecular formula C10H8F3NO5 and a molecular weight of 279.17 g/mol. Its IUPAC name is 5-methoxy-2-nitro-4-(2,2,2-trifluoroethoxy)benzaldehyde.
| Compound Name | 5-methoxy-2-nitro-4-(2,2,2-trifluoroethoxy)benzaldehyde |
|---|---|
| PubChem CID | 43311615 |
| Molecular Formula | C10H8F3NO5 |
| Molecular Weight | 279.17 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 5-methoxy-2-nitro-4-(2,2,2-trifluoroethoxy)benzaldehyde |
| SMILES | COc1cc(C=O)c([N+](=O)[O-])cc1OCC(F)(F)F |
| InChI | InChI=1S/C10H8F3NO5/c1-18-8-2-6(4-15)7(14(16)17)3-9(8)19-5-10(11,12)13/h2-4H,5H2,1H3 |
| InChIKey | NNFNWOPVAUSBFD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.17 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|