C14H18N2O4 — CID 65255458
5-[2-(hydroxymethyl)-4-nitrophenoxy]-2,2-dimethylpentanenitrile (PubChem CID 65255458) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 5-[2-(hydroxymethyl)-4-nitrophenoxy]-2,2-dimethylpentanenitrile.
| Compound Name | 5-[2-(hydroxymethyl)-4-nitrophenoxy]-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 65255458 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 5-[2-(hydroxymethyl)-4-nitrophenoxy]-2,2-dimethylpentanenitrile |
| SMILES | CC(C)(C#N)CCCOc1ccc([N+](=O)[O-])cc1CO |
| InChI | InChI=1S/C14H18N2O4/c1-14(2,10-15)6-3-7-20-13-5-4-12(16(18)19)8-11(13)9-17/h4-5,8,17H,3,6-7,9H2,1-2H3 |
| InChIKey | GZCNAVFGLFKTKF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 96.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|