C14H18ClNO2 — CID 65255404
5-[4-chloro-2-(hydroxymethyl)phenoxy]-2,2-dimethylpentanenitrile (PubChem CID 65255404) has the molecular formula C14H18ClNO2 and a molecular weight of 267.76 g/mol. Its IUPAC name is 5-[4-chloro-2-(hydroxymethyl)phenoxy]-2,2-dimethylpentanenitrile.
| Compound Name | 5-[4-chloro-2-(hydroxymethyl)phenoxy]-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 65255404 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 5-[4-chloro-2-(hydroxymethyl)phenoxy]-2,2-dimethylpentanenitrile |
| SMILES | CC(C)(C#N)CCCOc1ccc(Cl)cc1CO |
| InChI | InChI=1S/C14H18ClNO2/c1-14(2,10-16)6-3-7-18-13-5-4-12(15)8-11(13)9-17/h4-5,8,17H,3,6-7,9H2,1-2H3 |
| InChIKey | MBFMVACYMBOPNC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|