C15H20ClNO2 — CID 65255825
5-[4-chloro-2-(1-hydroxyethyl)phenoxy]-2,2-dimethylpentanenitrile (PubChem CID 65255825) has the molecular formula C15H20ClNO2 and a molecular weight of 281.78 g/mol. Its IUPAC name is 5-[4-chloro-2-(1-hydroxyethyl)phenoxy]-2,2-dimethylpentanenitrile.
| Compound Name | 5-[4-chloro-2-(1-hydroxyethyl)phenoxy]-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 65255825 |
| Molecular Formula | C15H20ClNO2 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 5-[4-chloro-2-(1-hydroxyethyl)phenoxy]-2,2-dimethylpentanenitrile |
| SMILES | CC(O)c1cc(Cl)ccc1OCCCC(C)(C)C#N |
| InChI | InChI=1S/C15H20ClNO2/c1-11(18)13-9-12(16)5-6-14(13)19-8-4-7-15(2,3)10-17/h5-6,9,11,18H,4,7-8H2,1-3H3 |
| InChIKey | LBZIJBAAIUZGPQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|