C14H21ClO2 — CID 78931515
(1S)-1-[5-chloro-2-(3,3-dimethylbutoxy)phenyl]ethanol (PubChem CID 78931515) has the molecular formula C14H21ClO2 and a molecular weight of 256.77 g/mol. Its IUPAC name is (1S)-1-[5-chloro-2-(3,3-dimethylbutoxy)phenyl]ethanol.
| Compound Name | (1S)-1-[5-chloro-2-(3,3-dimethylbutoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 78931515 |
| Molecular Formula | C14H21ClO2 |
| Molecular Weight | 256.77 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | (1S)-1-[5-chloro-2-(3,3-dimethylbutoxy)phenyl]ethanol |
| SMILES | C[C@H](O)c1cc(Cl)ccc1OCCC(C)(C)C |
| InChI | InChI=1S/C14H21ClO2/c1-10(16)12-9-11(15)5-6-13(12)17-8-7-14(2,3)4/h5-6,9-10,16H,7-8H2,1-4H3/t10-/m0/s1 |
| InChIKey | JGFCKTATJZCQFH-JTQLQIEISA-N |
| XLogP | 4.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.77 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |