C15H18ClNO2 — CID 65255690
5-(2-acetyl-4-chlorophenoxy)-2,2-dimethylpentanenitrile (PubChem CID 65255690) has the molecular formula C15H18ClNO2 and a molecular weight of 279.77 g/mol. Its IUPAC name is 5-(2-acetyl-4-chlorophenoxy)-2,2-dimethylpentanenitrile.
| Compound Name | 5-(2-acetyl-4-chlorophenoxy)-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 65255690 |
| Molecular Formula | C15H18ClNO2 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 5-(2-acetyl-4-chlorophenoxy)-2,2-dimethylpentanenitrile |
| SMILES | CC(=O)c1cc(Cl)ccc1OCCCC(C)(C)C#N |
| InChI | InChI=1S/C15H18ClNO2/c1-11(18)13-9-12(16)5-6-14(13)19-8-4-7-15(2,3)10-17/h5-6,9H,4,7-8H2,1-3H3 |
| InChIKey | CFRPUBUNPXVISA-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|