C17H23NO3 — CID 106710593
6-(4-acetyl-2-methoxyphenoxy)-2,2-dimethylhexanenitrile (PubChem CID 106710593) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 6-(4-acetyl-2-methoxyphenoxy)-2,2-dimethylhexanenitrile.
| Compound Name | 6-(4-acetyl-2-methoxyphenoxy)-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106710593 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 6-(4-acetyl-2-methoxyphenoxy)-2,2-dimethylhexanenitrile |
| SMILES | COc1cc(C(C)=O)ccc1OCCCCC(C)(C)C#N |
| InChI | InChI=1S/C17H23NO3/c1-13(19)14-7-8-15(16(11-14)20-4)21-10-6-5-9-17(2,3)12-18/h7-8,11H,5-6,9-10H2,1-4H3 |
| InChIKey | WLSVHRXTLPETLW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|