C15H21NO2 — CID 106710361
6-(2-methoxyphenoxy)-2,2-dimethylhexanenitrile (PubChem CID 106710361) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 6-(2-methoxyphenoxy)-2,2-dimethylhexanenitrile.
| Compound Name | 6-(2-methoxyphenoxy)-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106710361 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 6-(2-methoxyphenoxy)-2,2-dimethylhexanenitrile |
| SMILES | COc1ccccc1OCCCCC(C)(C)C#N |
| InChI | InChI=1S/C15H21NO2/c1-15(2,12-16)10-6-7-11-18-14-9-5-4-8-13(14)17-3/h4-5,8-9H,6-7,10-11H2,1-3H3 |
| InChIKey | AXPJOZBNIIPVGT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|