C16H23NO3 — CID 106712921
6-[5-(hydroxymethyl)-2-methoxyphenoxy]-2,2-dimethylhexanenitrile (PubChem CID 106712921) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 6-[5-(hydroxymethyl)-2-methoxyphenoxy]-2,2-dimethylhexanenitrile.
| Compound Name | 6-[5-(hydroxymethyl)-2-methoxyphenoxy]-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106712921 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 6-[5-(hydroxymethyl)-2-methoxyphenoxy]-2,2-dimethylhexanenitrile |
| SMILES | COc1ccc(CO)cc1OCCCCC(C)(C)C#N |
| InChI | InChI=1S/C16H23NO3/c1-16(2,12-17)8-4-5-9-20-15-10-13(11-18)6-7-14(15)19-3/h6-7,10,18H,4-5,8-9,11H2,1-3H3 |
| InChIKey | PGBLXFWRWDMMAZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|