C15H23NO3S — CID 107743132
5-[4-(hydroxymethyl)-2-methoxyphenoxy]-2,2-dimethylpentanethioamide (PubChem CID 107743132) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is 5-[4-(hydroxymethyl)-2-methoxyphenoxy]-2,2-dimethylpentanethioamide.
| Compound Name | 5-[4-(hydroxymethyl)-2-methoxyphenoxy]-2,2-dimethylpentanethioamide |
|---|---|
| PubChem CID | 107743132 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 5-[4-(hydroxymethyl)-2-methoxyphenoxy]-2,2-dimethylpentanethioamide |
| SMILES | COc1cc(CO)ccc1OCCCC(C)(C)C(N)=S |
| InChI | InChI=1S/C15H23NO3S/c1-15(2,14(16)20)7-4-8-19-12-6-5-11(10-17)9-13(12)18-3/h5-6,9,17H,4,7-8,10H2,1-3H3,(H2,16,20) |
| InChIKey | GFMFUYKWAVQXLN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|