C12H18N2O4 — CID 107744699
2-amino-4-[4-(hydroxymethyl)-2-methoxyphenoxy]butanamide (PubChem CID 107744699) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-amino-4-[4-(hydroxymethyl)-2-methoxyphenoxy]butanamide.
| Compound Name | 2-amino-4-[4-(hydroxymethyl)-2-methoxyphenoxy]butanamide |
|---|---|
| PubChem CID | 107744699 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 2-amino-4-[4-(hydroxymethyl)-2-methoxyphenoxy]butanamide |
| SMILES | COc1cc(CO)ccc1OCCC(N)C(N)=O |
| InChI | InChI=1S/C12H18N2O4/c1-17-11-6-8(7-15)2-3-10(11)18-5-4-9(13)12(14)16/h2-3,6,9,15H,4-5,7,13H2,1H3,(H2,14,16) |
| InChIKey | AJLNEFYAFVXTHY-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |