C14H22N2O4 — CID 62473722
2-amino-N-[(3,4-dimethoxyphenyl)methyl]-4-methoxybutanamide (PubChem CID 62473722) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is 2-amino-N-[(3,4-dimethoxyphenyl)methyl]-4-methoxybutanamide.
| Compound Name | 2-amino-N-[(3,4-dimethoxyphenyl)methyl]-4-methoxybutanamide |
|---|---|
| PubChem CID | 62473722 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 2-amino-N-[(3,4-dimethoxyphenyl)methyl]-4-methoxybutanamide |
| SMILES | COCCC(N)C(=O)NCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C14H22N2O4/c1-18-7-6-11(15)14(17)16-9-10-4-5-12(19-2)13(8-10)20-3/h4-5,8,11H,6-7,9,15H2,1-3H3,(H,16,17) |
| InChIKey | PXSBHPNJRGAMRR-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |