C14H21NO5 — CID 170884561
methyl 2-amino-3-[3-methoxy-4-(2-methoxyethoxy)phenyl]propanoate (PubChem CID 170884561) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is methyl 2-amino-3-[3-methoxy-4-(2-methoxyethoxy)phenyl]propanoate.
| Compound Name | methyl 2-amino-3-[3-methoxy-4-(2-methoxyethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 170884561 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | methyl 2-amino-3-[3-methoxy-4-(2-methoxyethoxy)phenyl]propanoate |
| SMILES | COCCOc1ccc(CC(N)C(=O)OC)cc1OC |
| InChI | InChI=1S/C14H21NO5/c1-17-6-7-20-12-5-4-10(9-13(12)18-2)8-11(15)14(16)19-3/h4-5,9,11H,6-8,15H2,1-3H3 |
| InChIKey | XXTWMLJWEBJKFF-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|