C11H16N2O3 — CID 14132751
2-amino-3-(3,4-dimethoxyphenyl)propanamide (PubChem CID 14132751) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-amino-3-(3,4-dimethoxyphenyl)propanamide.
| Compound Name | 2-amino-3-(3,4-dimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 14132751 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 2-amino-3-(3,4-dimethoxyphenyl)propanamide |
| SMILES | COc1ccc(CC(N)C(N)=O)cc1OC |
| InChI | InChI=1S/C11H16N2O3/c1-15-9-4-3-7(6-10(9)16-2)5-8(12)11(13)14/h3-4,6,8H,5,12H2,1-2H3,(H2,13,14) |
| InChIKey | BHNKSDJNSKZZRR-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |