C15H25N3O6 — CID 91873500
(2S)-2-amino-3-(3,4-dimethoxyphenyl)propanoic acid;2-[amino(methyl)amino]propanoic acid (PubChem CID 91873500) has the molecular formula C15H25N3O6 and a molecular weight of 343.38 g/mol. Its IUPAC name is (2S)-2-amino-3-(3,4-dimethoxyphenyl)propanoic acid;2-[amino(methyl)amino]propanoic acid.
| Compound Name | (2S)-2-amino-3-(3,4-dimethoxyphenyl)propanoic acid;2-[amino(methyl)amino]propanoic acid |
|---|---|
| PubChem CID | 91873500 |
| Molecular Formula | C15H25N3O6 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | (2S)-2-amino-3-(3,4-dimethoxyphenyl)propanoic acid;2-[amino(methyl)amino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)N.COc1ccc(C[C@H](N)C(=O)O)cc1OC |
| InChI | InChI=1S/C11H15NO4.C4H10N2O2/c1-15-9-4-3-7(6-10(9)16-2)5-8(12)11(13)14;1-3(4(7)8)6(2)5/h3-4,6,8H,5,12H2,1-2H3,(H,13,14);3H,5H2,1-2H3,(H,7,8)/t8-;/m0./s1 |
| InChIKey | SURWZHUSPOOMEK-QRPNPIFTSA-N |
| XLogP | -0.08 |
| TPSA | 148.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|