C22H26O8 — CID 10693323
(2R,3R)-2,3-bis[(3,4-dimethoxyphenyl)methyl]butanedioic acid (PubChem CID 10693323) has the molecular formula C22H26O8 and a molecular weight of 418.44 g/mol. Its IUPAC name is (2R,3R)-2,3-bis[(3,4-dimethoxyphenyl)methyl]butanedioic acid.
| Compound Name | (2R,3R)-2,3-bis[(3,4-dimethoxyphenyl)methyl]butanedioic acid |
|---|---|
| PubChem CID | 10693323 |
| Molecular Formula | C22H26O8 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | (2R,3R)-2,3-bis[(3,4-dimethoxyphenyl)methyl]butanedioic acid |
| SMILES | COc1ccc(C[C@@H](C(=O)O)[C@@H](Cc2ccc(OC)c(OC)c2)C(=O)O)cc1OC |
| InChI | InChI=1S/C22H26O8/c1-27-17-7-5-13(11-19(17)29-3)9-15(21(23)24)16(22(25)26)10-14-6-8-18(28-2)20(12-14)30-4/h5-8,11-12,15-16H,9-10H2,1-4H3,(H,23,24)(H,25,26)/t15-,16-/m1/s1 |
| InChIKey | NCLKBTXJCZVFDN-HZPDHXFCSA-N |
| XLogP | 2.91 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |