C12H16O4 — CID 130440860
(3R)-4-(3,4-dimethoxyphenyl)-3-hydroxybutan-2-one (PubChem CID 130440860) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is (3R)-4-(3,4-dimethoxyphenyl)-3-hydroxybutan-2-one.
| Compound Name | (3R)-4-(3,4-dimethoxyphenyl)-3-hydroxybutan-2-one |
|---|---|
| PubChem CID | 130440860 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (3R)-4-(3,4-dimethoxyphenyl)-3-hydroxybutan-2-one |
| SMILES | COc1ccc(C[C@@H](O)C(C)=O)cc1OC |
| InChI | InChI=1S/C12H16O4/c1-8(13)10(14)6-9-4-5-11(15-2)12(7-9)16-3/h4-5,7,10,14H,6H2,1-3H3/t10-/m1/s1 |
| InChIKey | PTJINPZIBFCVBG-SNVBAGLBSA-N |
| XLogP | 1.20 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |