C14H20O5 — CID 66289003
methyl 4-(3,4-dimethoxyphenyl)-2-hydroxy-3-methylbutanoate (PubChem CID 66289003) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is methyl 4-(3,4-dimethoxyphenyl)-2-hydroxy-3-methylbutanoate.
| Compound Name | methyl 4-(3,4-dimethoxyphenyl)-2-hydroxy-3-methylbutanoate |
|---|---|
| PubChem CID | 66289003 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | methyl 4-(3,4-dimethoxyphenyl)-2-hydroxy-3-methylbutanoate |
| SMILES | COC(=O)C(O)C(C)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C14H20O5/c1-9(13(15)14(16)19-4)7-10-5-6-11(17-2)12(8-10)18-3/h5-6,8-9,13,15H,7H2,1-4H3 |
| InChIKey | CMNUWHQCOIAKJD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |