C11H13BrO4 — CID 11077082
(2S)-2-bromo-3-(3,4-dimethoxyphenyl)propanoic acid (PubChem CID 11077082) has the molecular formula C11H13BrO4 and a molecular weight of 289.13 g/mol. Its IUPAC name is (2S)-2-bromo-3-(3,4-dimethoxyphenyl)propanoic acid.
| Compound Name | (2S)-2-bromo-3-(3,4-dimethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 11077082 |
| Molecular Formula | C11H13BrO4 |
| Molecular Weight | 289.13 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | (2S)-2-bromo-3-(3,4-dimethoxyphenyl)propanoic acid |
| SMILES | COc1ccc(C[C@H](Br)C(=O)O)cc1OC |
| InChI | InChI=1S/C11H13BrO4/c1-15-9-4-3-7(6-10(9)16-2)5-8(12)11(13)14/h3-4,6,8H,5H2,1-2H3,(H,13,14)/t8-/m0/s1 |
| InChIKey | RQYKQYGFIZODNU-QMMMGPOBSA-N |
| XLogP | 2.09 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.13 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|