C17H17BrO4 — CID 131887523
2-(4-bromophenyl)-3-(3,4-dimethoxyphenyl)propanoic acid (PubChem CID 131887523) has the molecular formula C17H17BrO4 and a molecular weight of 365.22 g/mol. Its IUPAC name is 2-(4-bromophenyl)-3-(3,4-dimethoxyphenyl)propanoic acid.
| Compound Name | 2-(4-bromophenyl)-3-(3,4-dimethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 131887523 |
| Molecular Formula | C17H17BrO4 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | 2-(4-bromophenyl)-3-(3,4-dimethoxyphenyl)propanoic acid |
| SMILES | COc1ccc(CC(C(=O)O)c2ccc(Br)cc2)cc1OC |
| InChI | InChI=1S/C17H17BrO4/c1-21-15-8-3-11(10-16(15)22-2)9-14(17(19)20)12-4-6-13(18)7-5-12/h3-8,10,14H,9H2,1-2H3,(H,19,20) |
| InChIKey | HSIOUJNJKNPSSJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |