C17H18O5 — CID 83955509
3-(3,4-dimethoxyphenyl)-2-(3-hydroxyphenyl)propanoic acid (PubChem CID 83955509) has the molecular formula C17H18O5 and a molecular weight of 302.33 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-2-(3-hydroxyphenyl)propanoic acid.
| Compound Name | 3-(3,4-dimethoxyphenyl)-2-(3-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 83955509 |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-2-(3-hydroxyphenyl)propanoic acid |
| SMILES | COc1ccc(CC(C(=O)O)c2cccc(O)c2)cc1OC |
| InChI | InChI=1S/C17H18O5/c1-21-15-7-6-11(9-16(15)22-2)8-14(17(19)20)12-4-3-5-13(18)10-12/h3-7,9-10,14,18H,8H2,1-2H3,(H,19,20) |
| InChIKey | VYEGBLUIHLFBOE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |