C22H29NO4 — CID 22682030
3-[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]-2-phenylpropanoic acid (PubChem CID 22682030) has the molecular formula C22H29NO4 and a molecular weight of 371.48 g/mol. Its IUPAC name is 3-[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]-2-phenylpropanoic acid.
| Compound Name | 3-[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 22682030 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 3-[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]-2-phenylpropanoic acid |
| SMILES | CCN(CC)CCOc1ccc(CC(C(=O)O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C22H29NO4/c1-4-23(5-2)13-14-27-20-12-11-17(16-21(20)26-3)15-19(22(24)25)18-9-7-6-8-10-18/h6-12,16,19H,4-5,13-15H2,1-3H3,(H,24,25) |
| InChIKey | SHNOTWBDRRITLL-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |