C16H26N2O4 — CID 3897212
2-amino-3-[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]propanoic acid (PubChem CID 3897212) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is 2-amino-3-[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]propanoic acid.
| Compound Name | 2-amino-3-[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 3897212 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 2-amino-3-[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]propanoic acid |
| SMILES | CCN(CC)CCOc1ccc(CC(N)C(=O)O)cc1OC |
| InChI | InChI=1S/C16H26N2O4/c1-4-18(5-2)8-9-22-14-7-6-12(11-15(14)21-3)10-13(17)16(19)20/h6-7,11,13H,4-5,8-10,17H2,1-3H3,(H,19,20) |
| InChIKey | YEWYGMRQLVNJAH-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |