C18H28N2O5 — CID 20992977
4-[[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]methylamino]-4-oxobutanoic acid (PubChem CID 20992977) has the molecular formula C18H28N2O5 and a molecular weight of 352.43 g/mol. Its IUPAC name is 4-[[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]methylamino]-4-oxobutanoic acid.
| Compound Name | 4-[[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]methylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 20992977 |
| Molecular Formula | C18H28N2O5 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 4-[[4-[2-(diethylamino)ethoxy]-3-methoxyphenyl]methylamino]-4-oxobutanoic acid |
| SMILES | CCN(CC)CCOc1ccc(CNC(=O)CCC(=O)O)cc1OC |
| InChI | InChI=1S/C18H28N2O5/c1-4-20(5-2)10-11-25-15-7-6-14(12-16(15)24-3)13-19-17(21)8-9-18(22)23/h6-7,12H,4-5,8-11,13H2,1-3H3,(H,19,21)(H,22,23) |
| InChIKey | MPKGLBRQVFXAOE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |