C20H23NO5 — CID 20987225
4-[[3-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methylamino]-4-oxobutanoic acid (PubChem CID 20987225) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is 4-[[3-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methylamino]-4-oxobutanoic acid.
| Compound Name | 4-[[3-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 20987225 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 4-[[3-methoxy-4-[(3-methylphenyl)methoxy]phenyl]methylamino]-4-oxobutanoic acid |
| SMILES | COc1cc(CNC(=O)CCC(=O)O)ccc1OCc1cccc(C)c1 |
| InChI | InChI=1S/C20H23NO5/c1-14-4-3-5-16(10-14)13-26-17-7-6-15(11-18(17)25-2)12-21-19(22)8-9-20(23)24/h3-7,10-11H,8-9,12-13H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | PBNMPIQTWUTYQQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |