C19H20NO5- — CID 9151302
4-[(3-methoxy-4-phenylmethoxyphenyl)methylamino]-4-oxobutanoate (PubChem CID 9151302) has the molecular formula C19H20NO5- and a molecular weight of 342.37 g/mol. Its IUPAC name is 4-[(3-methoxy-4-phenylmethoxyphenyl)methylamino]-4-oxobutanoate.
| Compound Name | 4-[(3-methoxy-4-phenylmethoxyphenyl)methylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 9151302 |
| Molecular Formula | C19H20NO5- |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 4-[(3-methoxy-4-phenylmethoxyphenyl)methylamino]-4-oxobutanoate |
| SMILES | COc1cc(CNC(=O)CCC(=O)[O-])ccc1OCc1ccccc1 |
| InChI | InChI=1S/C19H21NO5/c1-24-17-11-15(12-20-18(21)9-10-19(22)23)7-8-16(17)25-13-14-5-3-2-4-6-14/h2-8,11H,9-10,12-13H2,1H3,(H,20,21)(H,22,23)/p-1 |
| InChIKey | OTTXIPAXFBGNLK-UHFFFAOYSA-M |
| XLogP | 1.42 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |