C22H25NO5 — CID 9290919
[2-[(3-methoxy-4-phenylmethoxyphenyl)methylamino]-2-oxoethyl] 3-methylbut-2-enoate (PubChem CID 9290919) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is [2-[(3-methoxy-4-phenylmethoxyphenyl)methylamino]-2-oxoethyl] 3-methylbut-2-enoate.
| Compound Name | [2-[(3-methoxy-4-phenylmethoxyphenyl)methylamino]-2-oxoethyl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 9290919 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | [2-[(3-methoxy-4-phenylmethoxyphenyl)methylamino]-2-oxoethyl] 3-methylbut-2-enoate |
| SMILES | COc1cc(CNC(=O)COC(=O)C=C(C)C)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C22H25NO5/c1-16(2)11-22(25)28-15-21(24)23-13-18-9-10-19(20(12-18)26-3)27-14-17-7-5-4-6-8-17/h4-12H,13-15H2,1-3H3,(H,23,24) |
| InChIKey | JJQMSFASAXNBAQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|