C23H27NO5 — CID 9290865
[2-[(3-methoxy-4-phenylmethoxyphenyl)methyl-methylamino]-2-oxoethyl] 3-methylbut-2-enoate (PubChem CID 9290865) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is [2-[(3-methoxy-4-phenylmethoxyphenyl)methyl-methylamino]-2-oxoethyl] 3-methylbut-2-enoate.
| Compound Name | [2-[(3-methoxy-4-phenylmethoxyphenyl)methyl-methylamino]-2-oxoethyl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 9290865 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | [2-[(3-methoxy-4-phenylmethoxyphenyl)methyl-methylamino]-2-oxoethyl] 3-methylbut-2-enoate |
| SMILES | COc1cc(CN(C)C(=O)COC(=O)C=C(C)C)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C23H27NO5/c1-17(2)12-23(26)29-16-22(25)24(3)14-19-10-11-20(21(13-19)27-4)28-15-18-8-6-5-7-9-18/h5-13H,14-16H2,1-4H3 |
| InChIKey | STALJMZUQCMACK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|