C25H28N2O4 — CID 71214789
benzyl N-(2-aminoethyl)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]carbamate (PubChem CID 71214789) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is benzyl N-(2-aminoethyl)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]carbamate.
| Compound Name | benzyl N-(2-aminoethyl)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 71214789 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | benzyl N-(2-aminoethyl)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]carbamate |
| SMILES | COc1cc(CN(CCN)C(=O)OCc2ccccc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C25H28N2O4/c1-29-24-16-22(12-13-23(24)30-18-20-8-4-2-5-9-20)17-27(15-14-26)25(28)31-19-21-10-6-3-7-11-21/h2-13,16H,14-15,17-19,26H2,1H3 |
| InChIKey | OESDDZMUZMMZLT-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |