C25H29N3O3 — CID 71175731
1-(2-aminoethyl)-3-benzyl-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]urea (PubChem CID 71175731) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is 1-(2-aminoethyl)-3-benzyl-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]urea.
| Compound Name | 1-(2-aminoethyl)-3-benzyl-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 71175731 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 1-(2-aminoethyl)-3-benzyl-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]urea |
| SMILES | COc1cc(CN(CCN)C(=O)NCc2ccccc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C25H29N3O3/c1-30-24-16-22(12-13-23(24)31-19-21-10-6-3-7-11-21)18-28(15-14-26)25(29)27-17-20-8-4-2-5-9-20/h2-13,16H,14-15,17-19,26H2,1H3,(H,27,29) |
| InChIKey | YYQQWTNKORINAB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |