C24H34N2O3 — CID 42705085
1,3-dibutyl-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]urea (PubChem CID 42705085) has the molecular formula C24H34N2O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is 1,3-dibutyl-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]urea.
| Compound Name | 1,3-dibutyl-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 42705085 |
| Molecular Formula | C24H34N2O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | 1,3-dibutyl-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]urea |
| SMILES | CCCCNC(=O)N(CCCC)Cc1ccc(OCc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C24H34N2O3/c1-4-6-15-25-24(27)26(16-7-5-2)18-21-13-14-22(23(17-21)28-3)29-19-20-11-9-8-10-12-20/h8-14,17H,4-7,15-16,18-19H2,1-3H3,(H,25,27) |
| InChIKey | OCBZOEHIPPOAML-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|