C22H28Cl2N2O3 — CID 42709219
3-butyl-1-[2-(2,4-dichlorophenyl)ethyl]-1-[(3,4-dimethoxyphenyl)methyl]urea (PubChem CID 42709219) has the molecular formula C22H28Cl2N2O3 and a molecular weight of 439.38 g/mol. Its IUPAC name is 3-butyl-1-[2-(2,4-dichlorophenyl)ethyl]-1-[(3,4-dimethoxyphenyl)methyl]urea.
| Compound Name | 3-butyl-1-[2-(2,4-dichlorophenyl)ethyl]-1-[(3,4-dimethoxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 42709219 |
| Molecular Formula | C22H28Cl2N2O3 |
| Molecular Weight | 439.38 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | 3-butyl-1-[2-(2,4-dichlorophenyl)ethyl]-1-[(3,4-dimethoxyphenyl)methyl]urea |
| SMILES | CCCCNC(=O)N(CCc1ccc(Cl)cc1Cl)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C22H28Cl2N2O3/c1-4-5-11-25-22(27)26(12-10-17-7-8-18(23)14-19(17)24)15-16-6-9-20(28-2)21(13-16)29-3/h6-9,13-14H,4-5,10-12,15H2,1-3H3,(H,25,27) |
| InChIKey | PADHQLVMUJNPHU-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.38 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|