C20H23Cl2NO3 — CID 7964266
4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-N-pentylbenzamide (PubChem CID 7964266) has the molecular formula C20H23Cl2NO3 and a molecular weight of 396.31 g/mol. Its IUPAC name is 4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-N-pentylbenzamide.
| Compound Name | 4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-N-pentylbenzamide |
|---|---|
| PubChem CID | 7964266 |
| Molecular Formula | C20H23Cl2NO3 |
| Molecular Weight | 396.31 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-N-pentylbenzamide |
| SMILES | CCCCCNC(=O)c1ccc(OCc2ccc(Cl)cc2Cl)c(OC)c1 |
| InChI | InChI=1S/C20H23Cl2NO3/c1-3-4-5-10-23-20(24)14-7-9-18(19(11-14)25-2)26-13-15-6-8-16(21)12-17(15)22/h6-9,11-12H,3-5,10,13H2,1-2H3,(H,23,24) |
| InChIKey | XDOXISPFJPPVRS-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.31 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|