C19H20Cl2N2O4 — CID 9113306
4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-N-morpholin-4-ylbenzamide (PubChem CID 9113306) has the molecular formula C19H20Cl2N2O4 and a molecular weight of 411.29 g/mol. Its IUPAC name is 4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-N-morpholin-4-ylbenzamide.
| Compound Name | 4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-N-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 9113306 |
| Molecular Formula | C19H20Cl2N2O4 |
| Molecular Weight | 411.29 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 4-[(2,4-dichlorophenyl)methoxy]-3-methoxy-N-morpholin-4-ylbenzamide |
| SMILES | COc1cc(C(=O)NN2CCOCC2)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H20Cl2N2O4/c1-25-18-10-13(19(24)22-23-6-8-26-9-7-23)3-5-17(18)27-12-14-2-4-15(20)11-16(14)21/h2-5,10-11H,6-9,12H2,1H3,(H,22,24) |
| InChIKey | DPEGRBWKDGCXRW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.29 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |