C22H20Cl2N2O4S — CID 6218132
(5Z)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-morpholin-4-yl-1,3-thiazol-4-one (PubChem CID 6218132) has the molecular formula C22H20Cl2N2O4S and a molecular weight of 479.39 g/mol. Its IUPAC name is (5Z)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-morpholin-4-yl-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-morpholin-4-yl-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 6218132 |
| Molecular Formula | C22H20Cl2N2O4S |
| Molecular Weight | 479.39 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | (5Z)-5-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-morpholin-4-yl-1,3-thiazol-4-one |
| SMILES | COc1cc(/C=C2\SC(N3CCOCC3)=NC2=O)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H20Cl2N2O4S/c1-28-19-10-14(2-5-18(19)30-13-15-3-4-16(23)12-17(15)24)11-20-21(27)25-22(31-20)26-6-8-29-9-7-26/h2-5,10-12H,6-9,13H2,1H3/b20-11- |
| InChIKey | ZUJBTNDSJGCOEN-JAIQZWGSSA-N |
| XLogP | 4.88 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.39 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|