C25H28N2O3S — CID 21369741
(5Z)-2-(azepan-1-yl)-5-[[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-1,3-thiazol-4-one (PubChem CID 21369741) has the molecular formula C25H28N2O3S and a molecular weight of 436.58 g/mol. Its IUPAC name is (5Z)-2-(azepan-1-yl)-5-[[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-1,3-thiazol-4-one.
| Compound Name | (5Z)-2-(azepan-1-yl)-5-[[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 21369741 |
| Molecular Formula | C25H28N2O3S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | (5Z)-2-(azepan-1-yl)-5-[[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-1,3-thiazol-4-one |
| SMILES | COc1cc(/C=C2\SC(N3CCCCCC3)=NC2=O)ccc1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C25H28N2O3S/c1-18-7-9-19(10-8-18)17-30-21-12-11-20(15-22(21)29-2)16-23-24(28)26-25(31-23)27-13-5-3-4-6-14-27/h7-12,15-16H,3-6,13-14,17H2,1-2H3/b23-16- |
| InChIKey | IDVUBHJASDUEPU-KQWNVCNZSA-N |
| XLogP | 5.43 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|