C28H26N2O3S — CID 17045289
(5E)-5-[[3,4-bis(phenylmethoxy)phenyl]methylidene]-2-pyrrolidin-1-yl-1,3-thiazol-4-one (PubChem CID 17045289) has the molecular formula C28H26N2O3S and a molecular weight of 470.59 g/mol. Its IUPAC name is (5E)-5-[[3,4-bis(phenylmethoxy)phenyl]methylidene]-2-pyrrolidin-1-yl-1,3-thiazol-4-one.
| Compound Name | (5E)-5-[[3,4-bis(phenylmethoxy)phenyl]methylidene]-2-pyrrolidin-1-yl-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 17045289 |
| Molecular Formula | C28H26N2O3S |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | (5E)-5-[[3,4-bis(phenylmethoxy)phenyl]methylidene]-2-pyrrolidin-1-yl-1,3-thiazol-4-one |
| SMILES | O=C1N=C(N2CCCC2)S/C1=C/c1ccc(OCc2ccccc2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C28H26N2O3S/c31-27-26(34-28(29-27)30-15-7-8-16-30)18-23-13-14-24(32-19-21-9-3-1-4-10-21)25(17-23)33-20-22-11-5-2-6-12-22/h1-6,9-14,17-18H,7-8,15-16,19-20H2/b26-18+ |
| InChIKey | DGHQIMSEWBCCTJ-NLRVBDNBSA-N |
| XLogP | 5.91 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|