C28H25ClFN3O3S — CID 6137559
(5Z)-5-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-[4-(2-fluorophenyl)piperazin-1-yl]-1,3-thiazol-4-one (PubChem CID 6137559) has the molecular formula C28H25ClFN3O3S and a molecular weight of 538.04 g/mol. Its IUPAC name is (5Z)-5-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-[4-(2-fluorophenyl)piperazin-1-yl]-1,3-thiazol-4-one.
| Compound Name | (5Z)-5-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-[4-(2-fluorophenyl)piperazin-1-yl]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 6137559 |
| Molecular Formula | C28H25ClFN3O3S |
| Molecular Weight | 538.04 g/mol |
| Exact Mass | 537.13 |
| IUPAC Name | (5Z)-5-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-[4-(2-fluorophenyl)piperazin-1-yl]-1,3-thiazol-4-one |
| SMILES | COc1cc(/C=C2\SC(N3CCN(c4ccccc4F)CC3)=NC2=O)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H25ClFN3O3S/c1-35-25-16-20(8-11-24(25)36-18-19-6-9-21(29)10-7-19)17-26-27(34)31-28(37-26)33-14-12-32(13-15-33)23-5-3-2-4-22(23)30/h2-11,16-17H,12-15,18H2,1H3/b26-17- |
| InChIKey | WFRDEUVQMVGZPO-ONUIUJJFSA-N |
| XLogP | 5.86 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.04 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|