C28H26BrN3O3S — CID 17045321
(5E)-5-[[4-[(4-bromophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-(4-phenylpiperazin-1-yl)-1,3-thiazol-4-one (PubChem CID 17045321) has the molecular formula C28H26BrN3O3S and a molecular weight of 564.51 g/mol. Its IUPAC name is (5E)-5-[[4-[(4-bromophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-(4-phenylpiperazin-1-yl)-1,3-thiazol-4-one.
| Compound Name | (5E)-5-[[4-[(4-bromophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-(4-phenylpiperazin-1-yl)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 17045321 |
| Molecular Formula | C28H26BrN3O3S |
| Molecular Weight | 564.51 g/mol |
| Exact Mass | 563.09 |
| IUPAC Name | (5E)-5-[[4-[(4-bromophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-(4-phenylpiperazin-1-yl)-1,3-thiazol-4-one |
| SMILES | COc1cc(/C=C2/SC(N3CCN(c4ccccc4)CC3)=NC2=O)ccc1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C28H26BrN3O3S/c1-34-25-17-21(9-12-24(25)35-19-20-7-10-22(29)11-8-20)18-26-27(33)30-28(36-26)32-15-13-31(14-16-32)23-5-3-2-4-6-23/h2-12,17-18H,13-16,19H2,1H3/b26-18+ |
| InChIKey | LYVPKHZRETWGQD-NLRVBDNBSA-N |
| XLogP | 5.83 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.51 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|