C24H26BrN3O4S — CID 17045388
(5E)-5-[[4-[(4-bromophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-[4-(2-hydroxyethyl)piperazin-1-yl]-1,3-thiazol-4-one (PubChem CID 17045388) has the molecular formula C24H26BrN3O4S and a molecular weight of 532.46 g/mol. Its IUPAC name is (5E)-5-[[4-[(4-bromophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-[4-(2-hydroxyethyl)piperazin-1-yl]-1,3-thiazol-4-one.
| Compound Name | (5E)-5-[[4-[(4-bromophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-[4-(2-hydroxyethyl)piperazin-1-yl]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 17045388 |
| Molecular Formula | C24H26BrN3O4S |
| Molecular Weight | 532.46 g/mol |
| Exact Mass | 531.08 |
| IUPAC Name | (5E)-5-[[4-[(4-bromophenyl)methoxy]-3-methoxyphenyl]methylidene]-2-[4-(2-hydroxyethyl)piperazin-1-yl]-1,3-thiazol-4-one |
| SMILES | COc1cc(/C=C2/SC(N3CCN(CCO)CC3)=NC2=O)ccc1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C24H26BrN3O4S/c1-31-21-14-18(4-7-20(21)32-16-17-2-5-19(25)6-3-17)15-22-23(30)26-24(33-22)28-10-8-27(9-11-28)12-13-29/h2-7,14-15,29H,8-13,16H2,1H3/b22-15+ |
| InChIKey | XOCCASMFKBTRLC-PXLXIMEGSA-N |
| XLogP | 3.62 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|