C30H33F6N3O3S — CID 76618652
5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-2-(4-hexylpiperazin-1-yl)-1,3-thiazol-4-one (PubChem CID 76618652) has the molecular formula C30H33F6N3O3S and a molecular weight of 629.67 g/mol. Its IUPAC name is 5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-2-(4-hexylpiperazin-1-yl)-1,3-thiazol-4-one.
| Compound Name | 5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-2-(4-hexylpiperazin-1-yl)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 76618652 |
| Molecular Formula | C30H33F6N3O3S |
| Molecular Weight | 629.67 g/mol |
| Exact Mass | 629.21 |
| IUPAC Name | 5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-2-(4-hexylpiperazin-1-yl)-1,3-thiazol-4-one |
| SMILES | CCCCCCN1CCN(C2=NC(=O)C(=Cc3ccc(OCc4ccc(C(F)(F)F)cc4C(F)(F)F)c(OC)c3)S2)CC1 |
| InChI | InChI=1S/C30H33F6N3O3S/c1-3-4-5-6-11-38-12-14-39(15-13-38)28-37-27(40)26(43-28)17-20-7-10-24(25(16-20)41-2)42-19-21-8-9-22(29(31,32)33)18-23(21)30(34,35)36/h7-10,16-18H,3-6,11-15,19H2,1-2H3 |
| InChIKey | DLFILJBPMRNICO-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.67 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|