C32H27F6N3O5S — CID 76618710
2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-1,3-thiazol-4-one (PubChem CID 76618710) has the molecular formula C32H27F6N3O5S and a molecular weight of 679.64 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-1,3-thiazol-4-one.
| Compound Name | 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 76618710 |
| Molecular Formula | C32H27F6N3O5S |
| Molecular Weight | 679.64 g/mol |
| Exact Mass | 679.16 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-1,3-thiazol-4-one |
| SMILES | COc1cc(C=C2SC(N3CCN(Cc4ccc5c(c4)OCO5)CC3)=NC2=O)ccc1OCc1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C32H27F6N3O5S/c1-43-26-12-19(2-6-24(26)44-17-21-4-5-22(31(33,34)35)15-23(21)32(36,37)38)14-28-29(42)39-30(47-28)41-10-8-40(9-11-41)16-20-3-7-25-27(13-20)46-18-45-25/h2-7,12-15H,8-11,16-18H2,1H3 |
| InChIKey | XLOMEFPKXUUEAQ-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 72.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.64 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|