C24H20F6N2O4S — CID 87866123
5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-2-methoxyphenyl]methylidene]-2-morpholin-4-yl-1,3-thiazol-4-one (PubChem CID 87866123) has the molecular formula C24H20F6N2O4S and a molecular weight of 546.49 g/mol. Its IUPAC name is 5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-2-methoxyphenyl]methylidene]-2-morpholin-4-yl-1,3-thiazol-4-one.
| Compound Name | 5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-2-methoxyphenyl]methylidene]-2-morpholin-4-yl-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 87866123 |
| Molecular Formula | C24H20F6N2O4S |
| Molecular Weight | 546.49 g/mol |
| Exact Mass | 546.10 |
| IUPAC Name | 5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-2-methoxyphenyl]methylidene]-2-morpholin-4-yl-1,3-thiazol-4-one |
| SMILES | COc1cc(OCc2ccc(C(F)(F)F)cc2C(F)(F)F)ccc1C=C1SC(N2CCOCC2)=NC1=O |
| InChI | InChI=1S/C24H20F6N2O4S/c1-34-19-12-17(36-13-15-2-4-16(23(25,26)27)11-18(15)24(28,29)30)5-3-14(19)10-20-21(33)31-22(37-20)32-6-8-35-9-7-32/h2-5,10-12H,6-9,13H2,1H3 |
| InChIKey | MIRJIQRGOAEXDD-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.49 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|